C28H24F6O6S — CID 139190999
[(4R,5S)-4-[(2R)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoyl]oxy-4,5,6,7-tetrahydro-1-benzothiophen-5-yl] (2R)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate (PubChem CID 139190999) has the molecular formula C28H24F6O6S and a molecular weight of 602.55 g/mol. Its IUPAC name is [(4R,5S)-4-[(2R)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoyl]oxy-4,5,6,7-tetrahydro-1-benzothiophen-5-yl] (2R)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate.
| Compound Name | [(4R,5S)-4-[(2R)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoyl]oxy-4,5,6,7-tetrahydro-1-benzothiophen-5-yl] (2R)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate |
|---|---|
| PubChem CID | 139190999 |
| Molecular Formula | C28H24F6O6S |
| Molecular Weight | 602.55 g/mol |
| Exact Mass | 602.12 |
| IUPAC Name | [(4R,5S)-4-[(2R)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoyl]oxy-4,5,6,7-tetrahydro-1-benzothiophen-5-yl] (2R)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate |
| SMILES | CO[C@@](C(=O)O[C@H]1CCc2sccc2[C@H]1OC(=O)[C@](OC)(c1ccccc1)C(F)(F)F)(c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C28H24F6O6S/c1-37-25(27(29,30)31,17-9-5-3-6-10-17)23(35)39-20-13-14-21-19(15-16-41-21)22(20)40-24(36)26(38-2,28(32,33)34)18-11-7-4-8-12-18/h3-12,15-16,20,22H,13-14H2,1-2H3/t20-,22+,25+,26+/m0/s1 |
| InChIKey | YRQRQESGZOUPAE-STVNMGNLSA-N |
| XLogP | 6.40 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.55 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |