C28H22F6O6S — CID 139191000
[(2S,3R)-2-[(2R)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoyl]oxy-2,3-dihydro-1-benzothiophen-3-yl] (2R)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate (PubChem CID 139191000) has the molecular formula C28H22F6O6S and a molecular weight of 600.53 g/mol. Its IUPAC name is [(2S,3R)-2-[(2R)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoyl]oxy-2,3-dihydro-1-benzothiophen-3-yl] (2R)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate.
| Compound Name | [(2S,3R)-2-[(2R)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoyl]oxy-2,3-dihydro-1-benzothiophen-3-yl] (2R)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate |
|---|---|
| PubChem CID | 139191000 |
| Molecular Formula | C28H22F6O6S |
| Molecular Weight | 600.53 g/mol |
| Exact Mass | 600.10 |
| IUPAC Name | [(2S,3R)-2-[(2R)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoyl]oxy-2,3-dihydro-1-benzothiophen-3-yl] (2R)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate |
| SMILES | CO[C@@](C(=O)O[C@@H]1c2ccccc2S[C@@H]1OC(=O)[C@](OC)(c1ccccc1)C(F)(F)F)(c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C28H22F6O6S/c1-37-25(27(29,30)31,17-11-5-3-6-12-17)23(35)39-21-19-15-9-10-16-20(19)41-22(21)40-24(36)26(38-2,28(32,33)34)18-13-7-4-8-14-18/h3-16,21-22H,1-2H3/t21-,22+,25-,26-/m1/s1 |
| InChIKey | AFIZDRPXRSDSLG-USXZWKKNSA-N |
| XLogP | 6.45 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.53 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |