C26H21F6O3S+ — CID 171589677
[1,1,1-trifluoro-2-hydroxy-4-methyl-2-(trifluoromethyl)pentan-3-yl] 5-phenyldibenzothiophen-5-ium-2-carboxylate (PubChem CID 171589677) has the molecular formula C26H21F6O3S+ and a molecular weight of 527.51 g/mol. Its IUPAC name is [1,1,1-trifluoro-2-hydroxy-4-methyl-2-(trifluoromethyl)pentan-3-yl] 5-phenyldibenzothiophen-5-ium-2-carboxylate.
| Compound Name | [1,1,1-trifluoro-2-hydroxy-4-methyl-2-(trifluoromethyl)pentan-3-yl] 5-phenyldibenzothiophen-5-ium-2-carboxylate |
|---|---|
| PubChem CID | 171589677 |
| Molecular Formula | C26H21F6O3S+ |
| Molecular Weight | 527.51 g/mol |
| Exact Mass | 527.11 |
| IUPAC Name | [1,1,1-trifluoro-2-hydroxy-4-methyl-2-(trifluoromethyl)pentan-3-yl] 5-phenyldibenzothiophen-5-ium-2-carboxylate |
| SMILES | CC(C)C(OC(=O)c1ccc2c(c1)c1ccccc1[s+]2-c1ccccc1)C(O)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C26H21F6O3S/c1-15(2)22(24(34,25(27,28)29)26(30,31)32)35-23(33)16-12-13-21-19(14-16)18-10-6-7-11-20(18)36(21)17-8-4-3-5-9-17/h3-15,22,34H,1-2H3/q+1 |
| InChIKey | PUPBJTSHHGQWFD-UHFFFAOYSA-N |
| XLogP | 7.77 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.51 |
| LogP ≤ 5 | 7.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|