C25H18F4O2S — CID 67184725
ethyl 3-[4-fluoro-2-[[3-(trifluoromethyl)phenyl]methyl]-1-benzothiophen-7-yl]benzoate (PubChem CID 67184725) has the molecular formula C25H18F4O2S and a molecular weight of 458.48 g/mol. Its IUPAC name is ethyl 3-[4-fluoro-2-[[3-(trifluoromethyl)phenyl]methyl]-1-benzothiophen-7-yl]benzoate.
| Compound Name | ethyl 3-[4-fluoro-2-[[3-(trifluoromethyl)phenyl]methyl]-1-benzothiophen-7-yl]benzoate |
|---|---|
| PubChem CID | 67184725 |
| Molecular Formula | C25H18F4O2S |
| Molecular Weight | 458.48 g/mol |
| Exact Mass | 458.10 |
| IUPAC Name | ethyl 3-[4-fluoro-2-[[3-(trifluoromethyl)phenyl]methyl]-1-benzothiophen-7-yl]benzoate |
| SMILES | CCOC(=O)c1cccc(-c2ccc(F)c3cc(Cc4cccc(C(F)(F)F)c4)sc23)c1 |
| InChI | InChI=1S/C25H18F4O2S/c1-2-31-24(30)17-7-4-6-16(13-17)20-9-10-22(26)21-14-19(32-23(20)21)12-15-5-3-8-18(11-15)25(27,28)29/h3-11,13-14H,2,12H2,1H3 |
| InChIKey | KTJSZLCMACJPPX-UHFFFAOYSA-N |
| XLogP | 7.49 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.48 |
| LogP ≤ 5 | 7.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |