C23H14F4O2S — CID 68546644
3-[5-fluoro-2-[[3-(trifluoromethyl)phenyl]methyl]-1-benzothiophen-7-yl]benzoic acid (PubChem CID 68546644) has the molecular formula C23H14F4O2S and a molecular weight of 430.42 g/mol. Its IUPAC name is 3-[5-fluoro-2-[[3-(trifluoromethyl)phenyl]methyl]-1-benzothiophen-7-yl]benzoic acid.
| Compound Name | 3-[5-fluoro-2-[[3-(trifluoromethyl)phenyl]methyl]-1-benzothiophen-7-yl]benzoic acid |
|---|---|
| PubChem CID | 68546644 |
| Molecular Formula | C23H14F4O2S |
| Molecular Weight | 430.42 g/mol |
| Exact Mass | 430.07 |
| IUPAC Name | 3-[5-fluoro-2-[[3-(trifluoromethyl)phenyl]methyl]-1-benzothiophen-7-yl]benzoic acid |
| SMILES | O=C(O)c1cccc(-c2cc(F)cc3cc(Cc4cccc(C(F)(F)F)c4)sc23)c1 |
| InChI | InChI=1S/C23H14F4O2S/c24-18-10-16-11-19(8-13-3-1-6-17(7-13)23(25,26)27)30-21(16)20(12-18)14-4-2-5-15(9-14)22(28)29/h1-7,9-12H,8H2,(H,28,29) |
| InChIKey | WBJUCWARMYEJLJ-UHFFFAOYSA-N |
| XLogP | 7.02 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.42 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |