C17H9F7O3S2 — CID 86639192
[6-fluoro-2-[[3-(trifluoromethyl)phenyl]methyl]-1-benzothiophen-7-yl] trifluoromethanesulfonate (PubChem CID 86639192) has the molecular formula C17H9F7O3S2 and a molecular weight of 458.38 g/mol. Its IUPAC name is [6-fluoro-2-[[3-(trifluoromethyl)phenyl]methyl]-1-benzothiophen-7-yl] trifluoromethanesulfonate.
| Compound Name | [6-fluoro-2-[[3-(trifluoromethyl)phenyl]methyl]-1-benzothiophen-7-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 86639192 |
| Molecular Formula | C17H9F7O3S2 |
| Molecular Weight | 458.38 g/mol |
| Exact Mass | 457.99 |
| IUPAC Name | [6-fluoro-2-[[3-(trifluoromethyl)phenyl]methyl]-1-benzothiophen-7-yl] trifluoromethanesulfonate |
| SMILES | O=S(=O)(Oc1c(F)ccc2cc(Cc3cccc(C(F)(F)F)c3)sc12)C(F)(F)F |
| InChI | InChI=1S/C17H9F7O3S2/c18-13-5-4-10-8-12(7-9-2-1-3-11(6-9)16(19,20)21)28-15(10)14(13)27-29(25,26)17(22,23)24/h1-6,8H,7H2 |
| InChIKey | VIEXLALRCIUTDM-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.38 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|