C24H18O3S — CID 67185361
3-[2-[(3-acetylphenyl)methyl]-1-benzothiophen-7-yl]benzoic acid (PubChem CID 67185361) has the molecular formula C24H18O3S and a molecular weight of 386.47 g/mol. Its IUPAC name is 3-[2-[(3-acetylphenyl)methyl]-1-benzothiophen-7-yl]benzoic acid.
| Compound Name | 3-[2-[(3-acetylphenyl)methyl]-1-benzothiophen-7-yl]benzoic acid |
|---|---|
| PubChem CID | 67185361 |
| Molecular Formula | C24H18O3S |
| Molecular Weight | 386.47 g/mol |
| Exact Mass | 386.10 |
| IUPAC Name | 3-[2-[(3-acetylphenyl)methyl]-1-benzothiophen-7-yl]benzoic acid |
| SMILES | CC(=O)c1cccc(Cc2cc3cccc(-c4cccc(C(=O)O)c4)c3s2)c1 |
| InChI | InChI=1S/C24H18O3S/c1-15(25)17-6-2-5-16(11-17)12-21-14-19-8-4-10-22(23(19)28-21)18-7-3-9-20(13-18)24(26)27/h2-11,13-14H,12H2,1H3,(H,26,27) |
| InChIKey | MSXFFOTWGVHESF-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.47 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |