C44H39BrClFN2O4S2 — CID 67190547
3-[2-(bromomethyl)-1-benzothiophen-7-yl]-N-(2-methoxyethyl)benzamide;3-[2-[(4-chloro-3-fluorophenyl)methyl]-1-benzothiophen-7-yl]-N-(2-methoxyethyl)benzamide (PubChem CID 67190547) has the molecular formula C44H39BrClFN2O4S2 and a molecular weight of 858.29 g/mol. Its IUPAC name is 3-[2-(bromomethyl)-1-benzothiophen-7-yl]-N-(2-methoxyethyl)benzamide;3-[2-[(4-chloro-3-fluorophenyl)methyl]-1-benzothiophen-7-yl]-N-(2-methoxyethyl)benzamide.
| Compound Name | 3-[2-(bromomethyl)-1-benzothiophen-7-yl]-N-(2-methoxyethyl)benzamide;3-[2-[(4-chloro-3-fluorophenyl)methyl]-1-benzothiophen-7-yl]-N-(2-methoxyethyl)benzamide |
|---|---|
| PubChem CID | 67190547 |
| Molecular Formula | C44H39BrClFN2O4S2 |
| Molecular Weight | 858.29 g/mol |
| Exact Mass | 856.12 |
| IUPAC Name | 3-[2-(bromomethyl)-1-benzothiophen-7-yl]-N-(2-methoxyethyl)benzamide;3-[2-[(4-chloro-3-fluorophenyl)methyl]-1-benzothiophen-7-yl]-N-(2-methoxyethyl)benzamide |
| SMILES | COCCNC(=O)c1cccc(-c2cccc3cc(CBr)sc23)c1.COCCNC(=O)c1cccc(-c2cccc3cc(Cc4ccc(Cl)c(F)c4)sc23)c1 |
| InChI | InChI=1S/C25H21ClFNO2S.C19H18BrNO2S/c1-30-11-10-28-25(29)19-6-2-4-17(14-19)21-7-3-5-18-15-20(31-24(18)21)12-16-8-9-22(26)23(27)13-16;1-23-9-8-21-19(22)15-6-2-4-13(10-15)17-7-3-5-14-11-16(12-20)24-18(14)17/h2-9,13-15H,10-12H2,1H3,(H,28,29);2-7,10-11H,8-9,12H2,1H3,(H,21,22) |
| InChIKey | USAWSTXTDYAZCO-UHFFFAOYSA-N |
| XLogP | 11.17 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 858.29 |
| LogP ≤ 5 | 11.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|