C25H20ClF2NO2S — CID 59193846
5-[2-[(3-chloro-5-fluorophenyl)methyl]-1-benzothiophen-7-yl]-2-fluoro-N-(2-methoxyethyl)benzamide (PubChem CID 59193846) has the molecular formula C25H20ClF2NO2S and a molecular weight of 471.96 g/mol. Its IUPAC name is 5-[2-[(3-chloro-5-fluorophenyl)methyl]-1-benzothiophen-7-yl]-2-fluoro-N-(2-methoxyethyl)benzamide.
| Compound Name | 5-[2-[(3-chloro-5-fluorophenyl)methyl]-1-benzothiophen-7-yl]-2-fluoro-N-(2-methoxyethyl)benzamide |
|---|---|
| PubChem CID | 59193846 |
| Molecular Formula | C25H20ClF2NO2S |
| Molecular Weight | 471.96 g/mol |
| Exact Mass | 471.09 |
| IUPAC Name | 5-[2-[(3-chloro-5-fluorophenyl)methyl]-1-benzothiophen-7-yl]-2-fluoro-N-(2-methoxyethyl)benzamide |
| SMILES | COCCNC(=O)c1cc(-c2cccc3cc(Cc4cc(F)cc(Cl)c4)sc23)ccc1F |
| InChI | InChI=1S/C25H20ClF2NO2S/c1-31-8-7-29-25(30)22-13-16(5-6-23(22)28)21-4-2-3-17-12-20(32-24(17)21)11-15-9-18(26)14-19(27)10-15/h2-6,9-10,12-14H,7-8,11H2,1H3,(H,29,30) |
| InChIKey | AMOHJZVEAGLZIE-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.96 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|