C25H21ClFNO2S — CID 59193820
3-[2-[(3-chloro-4-fluorophenyl)methyl]-1-benzothiophen-7-yl]-N-(2-methoxyethyl)benzamide (PubChem CID 59193820) has the molecular formula C25H21ClFNO2S and a molecular weight of 453.97 g/mol. Its IUPAC name is 3-[2-[(3-chloro-4-fluorophenyl)methyl]-1-benzothiophen-7-yl]-N-(2-methoxyethyl)benzamide.
| Compound Name | 3-[2-[(3-chloro-4-fluorophenyl)methyl]-1-benzothiophen-7-yl]-N-(2-methoxyethyl)benzamide |
|---|---|
| PubChem CID | 59193820 |
| Molecular Formula | C25H21ClFNO2S |
| Molecular Weight | 453.97 g/mol |
| Exact Mass | 453.10 |
| IUPAC Name | 3-[2-[(3-chloro-4-fluorophenyl)methyl]-1-benzothiophen-7-yl]-N-(2-methoxyethyl)benzamide |
| SMILES | COCCNC(=O)c1cccc(-c2cccc3cc(Cc4ccc(F)c(Cl)c4)sc23)c1 |
| InChI | InChI=1S/C25H21ClFNO2S/c1-30-11-10-28-25(29)19-6-2-4-17(14-19)21-7-3-5-18-15-20(31-24(18)21)12-16-8-9-23(27)22(26)13-16/h2-9,13-15H,10-12H2,1H3,(H,28,29) |
| InChIKey | DHWOLNVEXDXBEA-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.97 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|