C26H22F3NO3S — CID 59193873
3-[2-[hydroxy-[3-(trifluoromethyl)phenyl]methyl]-1-benzothiophen-7-yl]-N-(2-methoxyethyl)benzamide (PubChem CID 59193873) has the molecular formula C26H22F3NO3S and a molecular weight of 485.53 g/mol. Its IUPAC name is 3-[2-[hydroxy-[3-(trifluoromethyl)phenyl]methyl]-1-benzothiophen-7-yl]-N-(2-methoxyethyl)benzamide.
| Compound Name | 3-[2-[hydroxy-[3-(trifluoromethyl)phenyl]methyl]-1-benzothiophen-7-yl]-N-(2-methoxyethyl)benzamide |
|---|---|
| PubChem CID | 59193873 |
| Molecular Formula | C26H22F3NO3S |
| Molecular Weight | 485.53 g/mol |
| Exact Mass | 485.13 |
| IUPAC Name | 3-[2-[hydroxy-[3-(trifluoromethyl)phenyl]methyl]-1-benzothiophen-7-yl]-N-(2-methoxyethyl)benzamide |
| SMILES | COCCNC(=O)c1cccc(-c2cccc3cc(C(O)c4cccc(C(F)(F)F)c4)sc23)c1 |
| InChI | InChI=1S/C26H22F3NO3S/c1-33-12-11-30-25(32)19-8-2-5-16(13-19)21-10-4-7-18-15-22(34-24(18)21)23(31)17-6-3-9-20(14-17)26(27,28)29/h2-10,13-15,23,31H,11-12H2,1H3,(H,30,32) |
| InChIKey | FSEHYJHGYIMFHW-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.53 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|