C26H21F4NO2S — CID 59194094
3-[3-fluoro-2-[[3-(trifluoromethyl)phenyl]methyl]-1-benzothiophen-7-yl]-N-(2-methoxyethyl)benzamide (PubChem CID 59194094) has the molecular formula C26H21F4NO2S and a molecular weight of 487.52 g/mol. Its IUPAC name is 3-[3-fluoro-2-[[3-(trifluoromethyl)phenyl]methyl]-1-benzothiophen-7-yl]-N-(2-methoxyethyl)benzamide.
| Compound Name | 3-[3-fluoro-2-[[3-(trifluoromethyl)phenyl]methyl]-1-benzothiophen-7-yl]-N-(2-methoxyethyl)benzamide |
|---|---|
| PubChem CID | 59194094 |
| Molecular Formula | C26H21F4NO2S |
| Molecular Weight | 487.52 g/mol |
| Exact Mass | 487.12 |
| IUPAC Name | 3-[3-fluoro-2-[[3-(trifluoromethyl)phenyl]methyl]-1-benzothiophen-7-yl]-N-(2-methoxyethyl)benzamide |
| SMILES | COCCNC(=O)c1cccc(-c2cccc3c(F)c(Cc4cccc(C(F)(F)F)c4)sc23)c1 |
| InChI | InChI=1S/C26H21F4NO2S/c1-33-12-11-31-25(32)18-7-3-6-17(15-18)20-9-4-10-21-23(27)22(34-24(20)21)14-16-5-2-8-19(13-16)26(28,29)30/h2-10,13,15H,11-12,14H2,1H3,(H,31,32) |
| InChIKey | CJRGCPSCOLVSTO-UHFFFAOYSA-N |
| XLogP | 6.69 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.52 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|