C24H22ClNOS2 — CID 70240153
1-[3-[2-[(5-chlorothiophen-2-yl)methyl]-1-benzothiophen-7-yl]phenyl]-N-(2-methoxyethyl)ethenamine (PubChem CID 70240153) has the molecular formula C24H22ClNOS2 and a molecular weight of 440.03 g/mol. Its IUPAC name is 1-[3-[2-[(5-chlorothiophen-2-yl)methyl]-1-benzothiophen-7-yl]phenyl]-N-(2-methoxyethyl)ethenamine.
| Compound Name | 1-[3-[2-[(5-chlorothiophen-2-yl)methyl]-1-benzothiophen-7-yl]phenyl]-N-(2-methoxyethyl)ethenamine |
|---|---|
| PubChem CID | 70240153 |
| Molecular Formula | C24H22ClNOS2 |
| Molecular Weight | 440.03 g/mol |
| Exact Mass | 439.08 |
| IUPAC Name | 1-[3-[2-[(5-chlorothiophen-2-yl)methyl]-1-benzothiophen-7-yl]phenyl]-N-(2-methoxyethyl)ethenamine |
| SMILES | C=C(NCCOC)c1cccc(-c2cccc3cc(Cc4ccc(Cl)s4)sc23)c1 |
| InChI | InChI=1S/C24H22ClNOS2/c1-16(26-11-12-27-2)17-5-3-6-18(13-17)22-8-4-7-19-14-21(29-24(19)22)15-20-9-10-23(25)28-20/h3-10,13-14,26H,1,11-12,15H2,2H3 |
| InChIKey | SFZYBAHVMVNQBN-UHFFFAOYSA-N |
| XLogP | 7.08 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.03 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|