C28H34N2O2S — CID 143941131
ethane;N-(2-methoxyethyl)-3-[2-[(Z)-4-methyl-2-methylidene-5-methyliminopent-3-enyl]-1-benzothiophen-7-yl]benzamide (PubChem CID 143941131) has the molecular formula C28H34N2O2S and a molecular weight of 462.66 g/mol. Its IUPAC name is ethane;N-(2-methoxyethyl)-3-[2-[(Z)-4-methyl-2-methylidene-5-methyliminopent-3-enyl]-1-benzothiophen-7-yl]benzamide.
| Compound Name | ethane;N-(2-methoxyethyl)-3-[2-[(Z)-4-methyl-2-methylidene-5-methyliminopent-3-enyl]-1-benzothiophen-7-yl]benzamide |
|---|---|
| PubChem CID | 143941131 |
| Molecular Formula | C28H34N2O2S |
| Molecular Weight | 462.66 g/mol |
| Exact Mass | 462.23 |
| IUPAC Name | ethane;N-(2-methoxyethyl)-3-[2-[(Z)-4-methyl-2-methylidene-5-methyliminopent-3-enyl]-1-benzothiophen-7-yl]benzamide |
| SMILES | C=C(/C=C(C)\C=N\C)Cc1cc2cccc(-c3cccc(C(=O)NCCOC)c3)c2s1.CC |
| InChI | InChI=1S/C26H28N2O2S.C2H6/c1-18(13-19(2)17-27-3)14-23-16-21-8-6-10-24(25(21)31-23)20-7-5-9-22(15-20)26(29)28-11-12-30-4;1-2/h5-10,13,15-17H,1,11-12,14H2,2-4H3,(H,28,29);1-2H3/b19-13-,27-17+; |
| InChIKey | WPXOKUSYHVEXMM-GSDDBRJLSA-N |
| XLogP | 6.72 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.66 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|