C25H22O4S2 — CID 67185788
ethyl 3-[2-[(3-methylsulfonylphenyl)methyl]-1-benzothiophen-7-yl]benzoate (PubChem CID 67185788) has the molecular formula C25H22O4S2 and a molecular weight of 450.58 g/mol. Its IUPAC name is ethyl 3-[2-[(3-methylsulfonylphenyl)methyl]-1-benzothiophen-7-yl]benzoate.
| Compound Name | ethyl 3-[2-[(3-methylsulfonylphenyl)methyl]-1-benzothiophen-7-yl]benzoate |
|---|---|
| PubChem CID | 67185788 |
| Molecular Formula | C25H22O4S2 |
| Molecular Weight | 450.58 g/mol |
| Exact Mass | 450.10 |
| IUPAC Name | ethyl 3-[2-[(3-methylsulfonylphenyl)methyl]-1-benzothiophen-7-yl]benzoate |
| SMILES | CCOC(=O)c1cccc(-c2cccc3cc(Cc4cccc(S(C)(=O)=O)c4)sc23)c1 |
| InChI | InChI=1S/C25H22O4S2/c1-3-29-25(26)20-10-5-8-18(15-20)23-12-6-9-19-16-21(30-24(19)23)13-17-7-4-11-22(14-17)31(2,27)28/h4-12,14-16H,3,13H2,1-2H3 |
| InChIKey | HCORYICYSHEDCZ-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.58 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |