About ethyl 3-[2-(bromomethyl)-4-fluoro-1-benzothiophen-7-yl]benzoate;tribromophosphane
ethyl 3-[2-(bromomethyl)-4-fluoro-1-benzothiophen-7-yl]benzoate;tribromophosphane (PubChem CID 87301781) has the molecular formula C18H14Br4FO2PS
and a molecular weight of 663.96 g/mol. Its IUPAC name is ethyl 3-[2-(bromomethyl)-4-fluoro-1-benzothiophen-7-yl]benzoate;tribromophosphane.
Molecular Properties
| Compound Name | ethyl 3-[2-(bromomethyl)-4-fluoro-1-benzothiophen-7-yl]benzoate;tribromophosphane |
| PubChem CID | 87301781 |
| Molecular Formula | C18H14Br4FO2PS |
| Molecular Weight | 663.96 g/mol |
| Exact Mass | 659.72 |
| IUPAC Name | ethyl 3-[2-(bromomethyl)-4-fluoro-1-benzothiophen-7-yl]benzoate;tribromophosphane |
| SMILES | BrP(Br)Br.CCOC(=O)c1cccc(-c2ccc(F)c3cc(CBr)sc23)c1 |
| InChI | InChI=1S/C18H14BrFO2S.Br3P/c1-2-22-18(21)12-5-3-4-11(8-12)14-6-7-16(20)15-9-13(10-19)23-17(14)15;1-4(2)3/h3-9H,2,10H2,1H3; |
| InChIKey | DYSVPBNJBWJRRD-UHFFFAOYSA-N |
| XLogP | 9.18 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 663.96 |
| LogP ≤ 5 | 9.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze ethyl 3-[2-(bromomethyl)-4-fluoro-1-benzothiophen-7-yl]benzoate;tribromophosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 3-[2-(bromomethyl)-4-fluoro-1-benzothiophen-7-yl]benzoate;tribromophosphane?
The IUPAC name of ethyl 3-[2-(bromomethyl)-4-fluoro-1-benzothiophen-7-yl]benzoate;tribromophosphane (CID 87301781) is ethyl 3-[2-(bromomethyl)-4-fluoro-1-benzothiophen-7-yl]benzoate;tribromophosphane.
What is the SMILES notation for ethyl 3-[2-(bromomethyl)-4-fluoro-1-benzothiophen-7-yl]benzoate;tribromophosphane?
The canonical SMILES for ethyl 3-[2-(bromomethyl)-4-fluoro-1-benzothiophen-7-yl]benzoate;tribromophosphane is BrP(Br)Br.CCOC(=O)c1cccc(-c2ccc(F)c3cc(CBr)sc23)c1.
What is the InChIKey of ethyl 3-[2-(bromomethyl)-4-fluoro-1-benzothiophen-7-yl]benzoate;tribromophosphane?
The InChIKey is DYSVPBNJBWJRRD-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H14BrFO2S.Br3P/c1-2-22-18(21)12-5-3-4-11(8-12)14-6-7-16(20)15-9-13(10-19)23-17(14)15;1-4(2)3/h3-9H,2,10H2,1H3;.
What are the key properties of ethyl 3-[2-(bromomethyl)-4-fluoro-1-benzothiophen-7-yl]benzoate;tribromophosphane?
ethyl 3-[2-(bromomethyl)-4-fluoro-1-benzothiophen-7-yl]benzoate;tribromophosphane has a molecular weight of 663.96 g/mol, XLogP of 9.18, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 3-[2-(bromomethyl)-4-fluoro-1-benzothiophen-7-yl]benzoate;tribromophosphane is sourced from PubChem (CID 87301781), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).