C25H19Br3F3O2PS — CID 87302058
ethyl 3-[2-[[3-(trifluoromethyl)phenyl]methyl]-1-benzothiophen-4-yl]benzoate;tribromophosphane (PubChem CID 87302058) has the molecular formula C25H19Br3F3O2PS and a molecular weight of 711.17 g/mol. Its IUPAC name is ethyl 3-[2-[[3-(trifluoromethyl)phenyl]methyl]-1-benzothiophen-4-yl]benzoate;tribromophosphane.
| Compound Name | ethyl 3-[2-[[3-(trifluoromethyl)phenyl]methyl]-1-benzothiophen-4-yl]benzoate;tribromophosphane |
|---|---|
| PubChem CID | 87302058 |
| Molecular Formula | C25H19Br3F3O2PS |
| Molecular Weight | 711.17 g/mol |
| Exact Mass | 707.83 |
| IUPAC Name | ethyl 3-[2-[[3-(trifluoromethyl)phenyl]methyl]-1-benzothiophen-4-yl]benzoate;tribromophosphane |
| SMILES | BrP(Br)Br.CCOC(=O)c1cccc(-c2cccc3sc(Cc4cccc(C(F)(F)F)c4)cc23)c1 |
| InChI | InChI=1S/C25H19F3O2S.Br3P/c1-2-30-24(29)18-8-4-7-17(14-18)21-10-5-11-23-22(21)15-20(31-23)13-16-6-3-9-19(12-16)25(26,27)28;1-4(2)3/h3-12,14-15H,2,13H2,1H3; |
| InChIKey | ZWJPMIOKYWDXPE-UHFFFAOYSA-N |
| XLogP | 10.75 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 711.17 |
| LogP ≤ 5 | 10.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|