C14H19NO3S — CID 139191756
(3S,4R)-3-(benzenesulfonyl)-4-methyl-1-propylpyrrolidin-2-one (PubChem CID 139191756) has the molecular formula C14H19NO3S and a molecular weight of 281.38 g/mol. Its IUPAC name is (3S,4R)-3-(benzenesulfonyl)-4-methyl-1-propylpyrrolidin-2-one.
| Compound Name | (3S,4R)-3-(benzenesulfonyl)-4-methyl-1-propylpyrrolidin-2-one |
|---|---|
| PubChem CID | 139191756 |
| Molecular Formula | C14H19NO3S |
| Molecular Weight | 281.38 g/mol |
| Exact Mass | 281.11 |
| IUPAC Name | (3S,4R)-3-(benzenesulfonyl)-4-methyl-1-propylpyrrolidin-2-one |
| SMILES | CCCN1C[C@@H](C)[C@H](S(=O)(=O)c2ccccc2)C1=O |
| InChI | InChI=1S/C14H19NO3S/c1-3-9-15-10-11(2)13(14(15)16)19(17,18)12-7-5-4-6-8-12/h4-8,11,13H,3,9-10H2,1-2H3/t11-,13+/m1/s1 |
| InChIKey | XOUQBKHZMIXLBB-YPMHNXCESA-N |
| XLogP | 1.72 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.38 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |