C27H22O — CID 139192251
(E,4E)-6-(4-methylphenyl)-4-[(4-methylphenyl)methylidene]-3-phenylhex-2-en-5-ynal (PubChem CID 139192251) has the molecular formula C27H22O and a molecular weight of 362.47 g/mol. Its IUPAC name is (E,4E)-6-(4-methylphenyl)-4-[(4-methylphenyl)methylidene]-3-phenylhex-2-en-5-ynal.
| Compound Name | (E,4E)-6-(4-methylphenyl)-4-[(4-methylphenyl)methylidene]-3-phenylhex-2-en-5-ynal |
|---|---|
| PubChem CID | 139192251 |
| Molecular Formula | C27H22O |
| Molecular Weight | 362.47 g/mol |
| Exact Mass | 362.17 |
| IUPAC Name | (E,4E)-6-(4-methylphenyl)-4-[(4-methylphenyl)methylidene]-3-phenylhex-2-en-5-ynal |
| SMILES | Cc1ccc(C#CC(=C\c2ccc(C)cc2)/C(=C/C=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C27H22O/c1-21-8-12-23(13-9-21)16-17-26(20-24-14-10-22(2)11-15-24)27(18-19-28)25-6-4-3-5-7-25/h3-15,18-20H,1-2H3/b26-20+,27-18+ |
| InChIKey | LIEUZMFDUQKXLQ-GHTAJSJVSA-N |
| XLogP | 6.02 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.47 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|