C20H24N2O3 — CID 139192280
(1S,3aR,4R,7S,7aS)-2-benzoyl-N-tert-butyl-1,3,3a,4,7,7a-hexahydro-4,7-epoxyisoindole-1-carboxamide (PubChem CID 139192280) has the molecular formula C20H24N2O3 and a molecular weight of 340.42 g/mol. Its IUPAC name is (1S,3aR,4R,7S,7aS)-2-benzoyl-N-tert-butyl-1,3,3a,4,7,7a-hexahydro-4,7-epoxyisoindole-1-carboxamide.
| Compound Name | (1S,3aR,4R,7S,7aS)-2-benzoyl-N-tert-butyl-1,3,3a,4,7,7a-hexahydro-4,7-epoxyisoindole-1-carboxamide |
|---|---|
| PubChem CID | 139192280 |
| Molecular Formula | C20H24N2O3 |
| Molecular Weight | 340.42 g/mol |
| Exact Mass | 340.18 |
| IUPAC Name | (1S,3aR,4R,7S,7aS)-2-benzoyl-N-tert-butyl-1,3,3a,4,7,7a-hexahydro-4,7-epoxyisoindole-1-carboxamide |
| SMILES | CC(C)(C)NC(=O)[C@@H]1[C@@H]2[C@H](CN1C(=O)c1ccccc1)[C@H]1C=C[C@@H]2O1 |
| InChI | InChI=1S/C20H24N2O3/c1-20(2,3)21-18(23)17-16-13(14-9-10-15(16)25-14)11-22(17)19(24)12-7-5-4-6-8-12/h4-10,13-17H,11H2,1-3H3,(H,21,23)/t13-,14-,15+,16-,17+/m1/s1 |
| InChIKey | IQAMXGFHCXOZSY-UUAJXVIYSA-N |
| XLogP | 2.00 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.42 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|