C35H33N5O7 — CID 139193253
[(1R,4S,7S,8R,10R)-8-(6-oxo-1H-purin-9-yl)-10-(trityloxymethyl)-2,6,9-trioxa-11-azatricyclo[5.3.1.04,11]undecan-4-yl]methyl acetate (PubChem CID 139193253) has the molecular formula C35H33N5O7 and a molecular weight of 635.68 g/mol. Its IUPAC name is [(1R,4S,7S,8R,10R)-8-(6-oxo-1H-purin-9-yl)-10-(trityloxymethyl)-2,6,9-trioxa-11-azatricyclo[5.3.1.04,11]undecan-4-yl]methyl acetate.
| Compound Name | [(1R,4S,7S,8R,10R)-8-(6-oxo-1H-purin-9-yl)-10-(trityloxymethyl)-2,6,9-trioxa-11-azatricyclo[5.3.1.04,11]undecan-4-yl]methyl acetate |
|---|---|
| PubChem CID | 139193253 |
| Molecular Formula | C35H33N5O7 |
| Molecular Weight | 635.68 g/mol |
| Exact Mass | 635.24 |
| IUPAC Name | [(1R,4S,7S,8R,10R)-8-(6-oxo-1H-purin-9-yl)-10-(trityloxymethyl)-2,6,9-trioxa-11-azatricyclo[5.3.1.04,11]undecan-4-yl]methyl acetate |
| SMILES | CC(=O)OC[C@]12CO[C@@H]3[C@@H](COC(c4ccccc4)(c4ccccc4)c4ccccc4)O[C@@H](n4cnc5c(=O)[nH]cnc54)[C@H](OC1)N32 |
| InChI | InChI=1S/C35H33N5O7/c1-23(41)43-18-34-19-44-31-27(47-32(33(40(31)34)45-20-34)39-22-38-28-29(39)36-21-37-30(28)42)17-46-35(24-11-5-2-6-12-24,25-13-7-3-8-14-25)26-15-9-4-10-16-26/h2-16,21-22,27,31-33H,17-20H2,1H3,(H,36,37,42)/t27-,31-,32-,33+,34+/m1/s1 |
| InChIKey | OHQIDUFDUOBGHX-XZYINIRYSA-N |
| XLogP | 3.34 |
| TPSA | 130.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.68 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|