C48H41N5O4 — CID 162409388
2-(tritylamino)-9-[6-(trityloxymethyl)-1,4-dioxan-2-yl]-1H-purin-6-one (PubChem CID 162409388) has the molecular formula C48H41N5O4 and a molecular weight of 751.89 g/mol. Its IUPAC name is 2-(tritylamino)-9-[6-(trityloxymethyl)-1,4-dioxan-2-yl]-1H-purin-6-one.
| Compound Name | 2-(tritylamino)-9-[6-(trityloxymethyl)-1,4-dioxan-2-yl]-1H-purin-6-one |
|---|---|
| PubChem CID | 162409388 |
| Molecular Formula | C48H41N5O4 |
| Molecular Weight | 751.89 g/mol |
| Exact Mass | 751.32 |
| IUPAC Name | 2-(tritylamino)-9-[6-(trityloxymethyl)-1,4-dioxan-2-yl]-1H-purin-6-one |
| SMILES | O=c1[nH]c(NC(c2ccccc2)(c2ccccc2)c2ccccc2)nc2c1ncn2C1COCC(COC(c2ccccc2)(c2ccccc2)c2ccccc2)O1 |
| InChI | InChI=1S/C48H41N5O4/c54-45-43-44(50-46(51-45)52-47(35-19-7-1-8-20-35,36-21-9-2-10-22-36)37-23-11-3-12-24-37)53(34-49-43)42-33-55-31-41(57-42)32-56-48(38-25-13-4-14-26-38,39-27-15-5-16-28-39)40-29-17-6-18-30-40/h1-30,34,41-42H,31-33H2,(H2,50,51,52,54) |
| InChIKey | GBLOVAACXMNYRK-UHFFFAOYSA-N |
| XLogP | 8.45 |
| TPSA | 103.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 751.89 |
| LogP ≤ 5 | 8.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|