C14H16F5NO2S — CID 139193507
(3S,4S)-4-[(pentafluoro-λ6-sulfanyl)methyl]-3-phenylmethoxy-1-prop-2-enylazetidin-2-one (PubChem CID 139193507) has the molecular formula C14H16F5NO2S and a molecular weight of 357.34 g/mol. Its IUPAC name is (3S,4S)-4-[(pentafluoro-λ6-sulfanyl)methyl]-3-phenylmethoxy-1-prop-2-enylazetidin-2-one.
| Compound Name | (3S,4S)-4-[(pentafluoro-λ6-sulfanyl)methyl]-3-phenylmethoxy-1-prop-2-enylazetidin-2-one |
|---|---|
| PubChem CID | 139193507 |
| Molecular Formula | C14H16F5NO2S |
| Molecular Weight | 357.34 g/mol |
| Exact Mass | 357.08 |
| IUPAC Name | (3S,4S)-4-[(pentafluoro-λ6-sulfanyl)methyl]-3-phenylmethoxy-1-prop-2-enylazetidin-2-one |
| SMILES | C=CCN1C(=O)[C@@H](OCc2ccccc2)[C@H]1CS(F)(F)(F)(F)F |
| InChI | InChI=1S/C14H16F5NO2S/c1-2-8-20-12(10-23(15,16,17,18)19)13(14(20)21)22-9-11-6-4-3-5-7-11/h2-7,12-13H,1,8-10H2/t12-,13+/m1/s1 |
| InChIKey | ZRLQQLDYOVBMEW-OLZOCXBDSA-N |
| XLogP | 4.27 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.34 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|