C16H20ClNO2 — CID 11335364
(3S,4S)-4-(2-chloropropan-2-yl)-3-phenylmethoxy-1-prop-2-enylazetidin-2-one (PubChem CID 11335364) has the molecular formula C16H20ClNO2 and a molecular weight of 293.79 g/mol. Its IUPAC name is (3S,4S)-4-(2-chloropropan-2-yl)-3-phenylmethoxy-1-prop-2-enylazetidin-2-one.
| Compound Name | (3S,4S)-4-(2-chloropropan-2-yl)-3-phenylmethoxy-1-prop-2-enylazetidin-2-one |
|---|---|
| PubChem CID | 11335364 |
| Molecular Formula | C16H20ClNO2 |
| Molecular Weight | 293.79 g/mol |
| Exact Mass | 293.12 |
| IUPAC Name | (3S,4S)-4-(2-chloropropan-2-yl)-3-phenylmethoxy-1-prop-2-enylazetidin-2-one |
| SMILES | C=CCN1C(=O)[C@@H](OCc2ccccc2)[C@H]1C(C)(C)Cl |
| InChI | InChI=1S/C16H20ClNO2/c1-4-10-18-14(16(2,3)17)13(15(18)19)20-11-12-8-6-5-7-9-12/h4-9,13-14H,1,10-11H2,2-3H3/t13-,14-/m0/s1 |
| InChIKey | QRMDQLFSRIJPHV-KBPBESRZSA-N |
| XLogP | 2.99 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.79 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|