C34H22Br2N2S — CID 139194582
(1S,12R,13S,24R)-12,24-dibromo-10,22-diphenyl-25-thia-3,15-diazahexacyclo[11.11.1.02,11.04,9.014,23.016,21]pentacosa-2,4,6,8,10,14,16,18,20,22-decaene (PubChem CID 139194582) has the molecular formula C34H22Br2N2S and a molecular weight of 650.44 g/mol. Its IUPAC name is (1S,12R,13S,24R)-12,24-dibromo-10,22-diphenyl-25-thia-3,15-diazahexacyclo[11.11.1.02,11.04,9.014,23.016,21]pentacosa-2,4,6,8,10,14,16,18,20,22-decaene.
| Compound Name | (1S,12R,13S,24R)-12,24-dibromo-10,22-diphenyl-25-thia-3,15-diazahexacyclo[11.11.1.02,11.04,9.014,23.016,21]pentacosa-2,4,6,8,10,14,16,18,20,22-decaene |
|---|---|
| PubChem CID | 139194582 |
| Molecular Formula | C34H22Br2N2S |
| Molecular Weight | 650.44 g/mol |
| Exact Mass | 647.99 |
| IUPAC Name | (1S,12R,13S,24R)-12,24-dibromo-10,22-diphenyl-25-thia-3,15-diazahexacyclo[11.11.1.02,11.04,9.014,23.016,21]pentacosa-2,4,6,8,10,14,16,18,20,22-decaene |
| SMILES | Br[C@@H]1c2c(nc3ccccc3c2-c2ccccc2)[C@@H]2S[C@H]1c1nc3ccccc3c(-c3ccccc3)c1[C@H]2Br |
| InChI | InChI=1S/C34H22Br2N2S/c35-29-27-25(19-11-3-1-4-12-19)21-15-7-9-17-23(21)37-31(27)34-30(36)28-26(20-13-5-2-6-14-20)22-16-8-10-18-24(22)38-32(28)33(29)39-34/h1-18,29-30,33-34H/t29-,30-,33-,34-/m1/s1 |
| InChIKey | JYZGFPPFSSBJSR-ZEDJEROUSA-N |
| XLogP | 10.53 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.44 |
| LogP ≤ 5 | 10.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|