About dicyclohexylazanium;(E)-3-(4-nitrophenyl)prop-2-enoate
dicyclohexylazanium;(E)-3-(4-nitrophenyl)prop-2-enoate (PubChem CID 139195253) has the molecular formula C21H30N2O4
and a molecular weight of 374.48 g/mol. Its IUPAC name is dicyclohexylazanium;(E)-3-(4-nitrophenyl)prop-2-enoate.
Molecular Properties
| Compound Name | dicyclohexylazanium;(E)-3-(4-nitrophenyl)prop-2-enoate |
| PubChem CID | 139195253 |
| Molecular Formula | C21H30N2O4 |
| Molecular Weight | 374.48 g/mol |
| Exact Mass | 374.22 |
| IUPAC Name | dicyclohexylazanium;(E)-3-(4-nitrophenyl)prop-2-enoate |
| SMILES | C1CCC([NH2+]C2CCCCC2)CC1.O=C([O-])/C=C/c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C12H23N.C9H7NO4/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;11-9(12)6-3-7-1-4-8(5-2-7)10(13)14/h11-13H,1-10H2;1-6H,(H,11,12)/b;6-3+ |
| InChIKey | RMJYIXLOKMPOIO-GNRCENTLSA-N |
| XLogP | 2.57 |
| TPSA | 99.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 374.48 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze dicyclohexylazanium;(E)-3-(4-nitrophenyl)prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dicyclohexylazanium;(E)-3-(4-nitrophenyl)prop-2-enoate?
The IUPAC name of dicyclohexylazanium;(E)-3-(4-nitrophenyl)prop-2-enoate (CID 139195253) is dicyclohexylazanium;(E)-3-(4-nitrophenyl)prop-2-enoate.
What is the SMILES notation for dicyclohexylazanium;(E)-3-(4-nitrophenyl)prop-2-enoate?
The canonical SMILES for dicyclohexylazanium;(E)-3-(4-nitrophenyl)prop-2-enoate is C1CCC([NH2+]C2CCCCC2)CC1.O=C([O-])/C=C/c1ccc([N+](=O)[O-])cc1.
What is the InChIKey of dicyclohexylazanium;(E)-3-(4-nitrophenyl)prop-2-enoate?
The InChIKey is RMJYIXLOKMPOIO-GNRCENTLSA-N. The full InChI is InChI=1S/C12H23N.C9H7NO4/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;11-9(12)6-3-7-1-4-8(5-2-7)10(13)14/h11-13H,1-10H2;1-6H,(H,11,12)/b;6-3+.
What are the key properties of dicyclohexylazanium;(E)-3-(4-nitrophenyl)prop-2-enoate?
dicyclohexylazanium;(E)-3-(4-nitrophenyl)prop-2-enoate has a molecular weight of 374.48 g/mol, XLogP of 2.57, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for dicyclohexylazanium;(E)-3-(4-nitrophenyl)prop-2-enoate is sourced from PubChem (CID 139195253), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).