C34H36N6O12S4 — CID 139196156
hexanedioic acid;bis(4-hydroxy-2-methyl-N-(5-methyl-1,3-thiazol-2-yl)-1,1-dioxo-1λ6,2-benzothiazine-3-carboxamide) (PubChem CID 139196156) has the molecular formula C34H36N6O12S4 and a molecular weight of 848.96 g/mol. Its IUPAC name is hexanedioic acid;bis(4-hydroxy-2-methyl-N-(5-methyl-1,3-thiazol-2-yl)-1,1-dioxo-1λ6,2-benzothiazine-3-carboxamide).
| Compound Name | hexanedioic acid;bis(4-hydroxy-2-methyl-N-(5-methyl-1,3-thiazol-2-yl)-1,1-dioxo-1λ6,2-benzothiazine-3-carboxamide) |
|---|---|
| PubChem CID | 139196156 |
| Molecular Formula | C34H36N6O12S4 |
| Molecular Weight | 848.96 g/mol |
| Exact Mass | 848.13 |
| IUPAC Name | hexanedioic acid;bis(4-hydroxy-2-methyl-N-(5-methyl-1,3-thiazol-2-yl)-1,1-dioxo-1λ6,2-benzothiazine-3-carboxamide) |
| SMILES | Cc1cnc(NC(=O)C2=C(O)c3ccccc3S(=O)(=O)N2C)s1.Cc1cnc(NC(=O)C2=C(O)c3ccccc3S(=O)(=O)N2C)s1.O=C(O)CCCCC(=O)O |
| InChI | InChI=1S/2C14H13N3O4S2.C6H10O4/c2*1-8-7-15-14(22-8)16-13(19)11-12(18)9-5-3-4-6-10(9)23(20,21)17(11)2;7-5(8)3-1-2-4-6(9)10/h2*3-7,18H,1-2H3,(H,15,16,19);1-4H2,(H,7,8)(H,9,10) |
| InChIKey | LDJZLUQGDUCMFZ-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 273.80 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 56 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 848.96 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|