C13H10IN3O4S2 — CID 142985322
4-hydroxy-2-iodo-N-(5-methyl-1,3-thiazol-2-yl)-1,1-dioxo-1λ6,2-benzothiazine-3-carboxamide (PubChem CID 142985322) has the molecular formula C13H10IN3O4S2 and a molecular weight of 463.28 g/mol. Its IUPAC name is 4-hydroxy-2-iodo-N-(5-methyl-1,3-thiazol-2-yl)-1,1-dioxo-1λ6,2-benzothiazine-3-carboxamide.
| Compound Name | 4-hydroxy-2-iodo-N-(5-methyl-1,3-thiazol-2-yl)-1,1-dioxo-1λ6,2-benzothiazine-3-carboxamide |
|---|---|
| PubChem CID | 142985322 |
| Molecular Formula | C13H10IN3O4S2 |
| Molecular Weight | 463.28 g/mol |
| Exact Mass | 462.92 |
| IUPAC Name | 4-hydroxy-2-iodo-N-(5-methyl-1,3-thiazol-2-yl)-1,1-dioxo-1λ6,2-benzothiazine-3-carboxamide |
| SMILES | Cc1cnc(NC(=O)C2=C(O)c3ccccc3S(=O)(=O)N2I)s1 |
| InChI | InChI=1S/C13H10IN3O4S2/c1-7-6-15-13(22-7)16-12(19)10-11(18)8-4-2-3-5-9(8)23(20,21)17(10)14/h2-6,18H,1H3,(H,15,16,19) |
| InChIKey | RJNRBFXHQHQDHN-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 99.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.28 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|