C27H14F5N3 — CID 139197313
4-[4-(2,3,4,5,6-pentafluorophenyl)phenyl]-2,6-dipyridin-4-ylpyridine (PubChem CID 139197313) has the molecular formula C27H14F5N3 and a molecular weight of 475.42 g/mol. Its IUPAC name is 4-[4-(2,3,4,5,6-pentafluorophenyl)phenyl]-2,6-dipyridin-4-ylpyridine.
| Compound Name | 4-[4-(2,3,4,5,6-pentafluorophenyl)phenyl]-2,6-dipyridin-4-ylpyridine |
|---|---|
| PubChem CID | 139197313 |
| Molecular Formula | C27H14F5N3 |
| Molecular Weight | 475.42 g/mol |
| Exact Mass | 475.11 |
| IUPAC Name | 4-[4-(2,3,4,5,6-pentafluorophenyl)phenyl]-2,6-dipyridin-4-ylpyridine |
| SMILES | Fc1c(F)c(F)c(-c2ccc(-c3cc(-c4ccncc4)nc(-c4ccncc4)c3)cc2)c(F)c1F |
| InChI | InChI=1S/C27H14F5N3/c28-23-22(24(29)26(31)27(32)25(23)30)18-3-1-15(2-4-18)19-13-20(16-5-9-33-10-6-16)35-21(14-19)17-7-11-34-12-8-17/h1-14H |
| InChIKey | MAZBLQOKXYWUIO-UHFFFAOYSA-N |
| XLogP | 7.24 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.42 |
| LogP ≤ 5 | 7.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|