C18H15F6N4OPS — CID 139198310
methanol;2-thiophen-2-yl-3H-imidazo[4,5-f][1,10]phenanthrolin-8-ium;hexafluorophosphate (PubChem CID 139198310) has the molecular formula C18H15F6N4OPS and a molecular weight of 480.37 g/mol. Its IUPAC name is methanol;2-thiophen-2-yl-3H-imidazo[4,5-f][1,10]phenanthrolin-8-ium;hexafluorophosphate.
| Compound Name | methanol;2-thiophen-2-yl-3H-imidazo[4,5-f][1,10]phenanthrolin-8-ium;hexafluorophosphate |
|---|---|
| PubChem CID | 139198310 |
| Molecular Formula | C18H15F6N4OPS |
| Molecular Weight | 480.37 g/mol |
| Exact Mass | 480.06 |
| IUPAC Name | methanol;2-thiophen-2-yl-3H-imidazo[4,5-f][1,10]phenanthrolin-8-ium;hexafluorophosphate |
| SMILES | CO.F[P-](F)(F)(F)(F)F.c1csc(-c2nc3c4ccc[nH+]c4c4ncccc4c3[nH]2)c1 |
| InChI | InChI=1S/C17H10N4S.CH4O.F6P/c1-4-10-13(18-7-1)14-11(5-2-8-19-14)16-15(10)20-17(21-16)12-6-3-9-22-12;1-2;1-7(2,3,4,5)6/h1-9H,(H,20,21);2H,1H3;/q;;-1/p+1 |
| InChIKey | YLSVPCADEDCGBH-UHFFFAOYSA-O |
| XLogP | 6.80 |
| TPSA | 75.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.37 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|