About bis(2-[(1S)-1-(1H-indol-3-yl)ethyl]phenol);hydrate
bis(2-[(1S)-1-(1H-indol-3-yl)ethyl]phenol);hydrate (PubChem CID 139199506) has the molecular formula C32H32N2O3
and a molecular weight of 492.62 g/mol. Its IUPAC name is bis(2-[(1S)-1-(1H-indol-3-yl)ethyl]phenol);hydrate.
Molecular Properties
| Compound Name | bis(2-[(1S)-1-(1H-indol-3-yl)ethyl]phenol);hydrate |
| PubChem CID | 139199506 |
| Molecular Formula | C32H32N2O3 |
| Molecular Weight | 492.62 g/mol |
| Exact Mass | 492.24 |
| IUPAC Name | bis(2-[(1S)-1-(1H-indol-3-yl)ethyl]phenol);hydrate |
| SMILES | C[C@H](c1ccccc1O)c1c[nH]c2ccccc12.C[C@H](c1ccccc1O)c1c[nH]c2ccccc12.O |
| InChI | InChI=1S/2C16H15NO.H2O/c2*1-11(12-6-3-5-9-16(12)18)14-10-17-15-8-4-2-7-13(14)15;/h2*2-11,17-18H,1H3;1H2/t2*11-;/m11./s1 |
| InChIKey | ZHZZOXFTMHVSBM-ZVRYYDNZSA-N |
| XLogP | 7.23 |
| TPSA | 103.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 492.62 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze bis(2-[(1S)-1-(1H-indol-3-yl)ethyl]phenol);hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(2-[(1S)-1-(1H-indol-3-yl)ethyl]phenol);hydrate?
The IUPAC name of bis(2-[(1S)-1-(1H-indol-3-yl)ethyl]phenol);hydrate (CID 139199506) is bis(2-[(1S)-1-(1H-indol-3-yl)ethyl]phenol);hydrate.
What is the SMILES notation for bis(2-[(1S)-1-(1H-indol-3-yl)ethyl]phenol);hydrate?
The canonical SMILES for bis(2-[(1S)-1-(1H-indol-3-yl)ethyl]phenol);hydrate is C[C@H](c1ccccc1O)c1c[nH]c2ccccc12.C[C@H](c1ccccc1O)c1c[nH]c2ccccc12.O.
What is the InChIKey of bis(2-[(1S)-1-(1H-indol-3-yl)ethyl]phenol);hydrate?
The InChIKey is ZHZZOXFTMHVSBM-ZVRYYDNZSA-N. The full InChI is InChI=1S/2C16H15NO.H2O/c2*1-11(12-6-3-5-9-16(12)18)14-10-17-15-8-4-2-7-13(14)15;/h2*2-11,17-18H,1H3;1H2/t2*11-;/m11./s1.
What are the key properties of bis(2-[(1S)-1-(1H-indol-3-yl)ethyl]phenol);hydrate?
bis(2-[(1S)-1-(1H-indol-3-yl)ethyl]phenol);hydrate has a molecular weight of 492.62 g/mol, XLogP of 7.23, 4 rotatable bonds, 4 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for bis(2-[(1S)-1-(1H-indol-3-yl)ethyl]phenol);hydrate is sourced from PubChem (CID 139199506), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).