C26H20N4O2S — CID 139199582
5-[5-(3-butylimidazo[4,5-f][1,10]phenanthrolin-2-yl)thiophen-2-yl]furan-2-carbaldehyde (PubChem CID 139199582) has the molecular formula C26H20N4O2S and a molecular weight of 452.54 g/mol. Its IUPAC name is 5-[5-(3-butylimidazo[4,5-f][1,10]phenanthrolin-2-yl)thiophen-2-yl]furan-2-carbaldehyde.
| Compound Name | 5-[5-(3-butylimidazo[4,5-f][1,10]phenanthrolin-2-yl)thiophen-2-yl]furan-2-carbaldehyde |
|---|---|
| PubChem CID | 139199582 |
| Molecular Formula | C26H20N4O2S |
| Molecular Weight | 452.54 g/mol |
| Exact Mass | 452.13 |
| IUPAC Name | 5-[5-(3-butylimidazo[4,5-f][1,10]phenanthrolin-2-yl)thiophen-2-yl]furan-2-carbaldehyde |
| SMILES | CCCCn1c(-c2ccc(-c3ccc(C=O)o3)s2)nc2c3cccnc3c3ncccc3c21 |
| InChI | InChI=1S/C26H20N4O2S/c1-2-3-14-30-25-18-7-5-13-28-23(18)22-17(6-4-12-27-22)24(25)29-26(30)21-11-10-20(33-21)19-9-8-16(15-31)32-19/h4-13,15H,2-3,14H2,1H3 |
| InChIKey | ULSBQSMXFGIMDV-UHFFFAOYSA-N |
| XLogP | 6.73 |
| TPSA | 73.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.54 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|