C38H22F6N4OS — CID 139244342
2-[4-[4-[3,3,4,4,5,5-hexafluoro-2-(2-methyl-1-benzofuran-3-yl)cyclopenten-1-yl]-5-methylthiophen-2-yl]phenyl]-1H-imidazo[4,5-f][1,10]phenanthroline (PubChem CID 139244342) has the molecular formula C38H22F6N4OS and a molecular weight of 696.68 g/mol. Its IUPAC name is 2-[4-[4-[3,3,4,4,5,5-hexafluoro-2-(2-methyl-1-benzofuran-3-yl)cyclopenten-1-yl]-5-methylthiophen-2-yl]phenyl]-1H-imidazo[4,5-f][1,10]phenanthroline.
| Compound Name | 2-[4-[4-[3,3,4,4,5,5-hexafluoro-2-(2-methyl-1-benzofuran-3-yl)cyclopenten-1-yl]-5-methylthiophen-2-yl]phenyl]-1H-imidazo[4,5-f][1,10]phenanthroline |
|---|---|
| PubChem CID | 139244342 |
| Molecular Formula | C38H22F6N4OS |
| Molecular Weight | 696.68 g/mol |
| Exact Mass | 696.14 |
| IUPAC Name | 2-[4-[4-[3,3,4,4,5,5-hexafluoro-2-(2-methyl-1-benzofuran-3-yl)cyclopenten-1-yl]-5-methylthiophen-2-yl]phenyl]-1H-imidazo[4,5-f][1,10]phenanthroline |
| SMILES | Cc1oc2ccccc2c1C1=C(c2cc(-c3ccc(-c4nc5c6cccnc6c6ncccc6c5[nH]4)cc3)sc2C)C(F)(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C38H22F6N4OS/c1-18-28(22-7-3-4-10-26(22)49-18)30-29(36(39,40)38(43,44)37(30,41)42)25-17-27(50-19(25)2)20-11-13-21(14-12-20)35-47-33-23-8-5-15-45-31(23)32-24(34(33)48-35)9-6-16-46-32/h3-17H,1-2H3,(H,47,48) |
| InChIKey | CDJNFGHMXKCGAA-UHFFFAOYSA-N |
| XLogP | 11.25 |
| TPSA | 67.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 696.68 |
| LogP ≤ 5 | 11.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|