C34H25Cl3N4S2 — CID 139199583
3-butyl-2-(5-dibenzothiophen-4-ylthiophen-2-yl)imidazo[4,5-f][1,10]phenanthroline;chloroform (PubChem CID 139199583) has the molecular formula C34H25Cl3N4S2 and a molecular weight of 660.10 g/mol. Its IUPAC name is 3-butyl-2-(5-dibenzothiophen-4-ylthiophen-2-yl)imidazo[4,5-f][1,10]phenanthroline;chloroform.
| Compound Name | 3-butyl-2-(5-dibenzothiophen-4-ylthiophen-2-yl)imidazo[4,5-f][1,10]phenanthroline;chloroform |
|---|---|
| PubChem CID | 139199583 |
| Molecular Formula | C34H25Cl3N4S2 |
| Molecular Weight | 660.10 g/mol |
| Exact Mass | 658.06 |
| IUPAC Name | 3-butyl-2-(5-dibenzothiophen-4-ylthiophen-2-yl)imidazo[4,5-f][1,10]phenanthroline;chloroform |
| SMILES | CCCCn1c(-c2ccc(-c3cccc4c3sc3ccccc34)s2)nc2c3cccnc3c3ncccc3c21.ClC(Cl)Cl |
| InChI | InChI=1S/C33H24N4S2.CHCl3/c1-2-3-19-37-31-24-13-8-18-35-29(24)28-23(12-7-17-34-28)30(31)36-33(37)27-16-15-26(38-27)22-11-6-10-21-20-9-4-5-14-25(20)39-32(21)22;2-1(3)4/h4-18H,2-3,19H2,1H3;1H |
| InChIKey | YVBFUVKOPBVIBE-UHFFFAOYSA-N |
| XLogP | 11.68 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.10 |
| LogP ≤ 5 | 11.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|