C28H24FNO2 — CID 139200188
(2E,4E)-5-[3-(4-fluorophenyl)-1-propan-2-ylindol-2-yl]-1-(2-hydroxyphenyl)penta-2,4-dien-1-one (PubChem CID 139200188) has the molecular formula C28H24FNO2 and a molecular weight of 425.50 g/mol. Its IUPAC name is (2E,4E)-5-[3-(4-fluorophenyl)-1-propan-2-ylindol-2-yl]-1-(2-hydroxyphenyl)penta-2,4-dien-1-one.
| Compound Name | (2E,4E)-5-[3-(4-fluorophenyl)-1-propan-2-ylindol-2-yl]-1-(2-hydroxyphenyl)penta-2,4-dien-1-one |
|---|---|
| PubChem CID | 139200188 |
| Molecular Formula | C28H24FNO2 |
| Molecular Weight | 425.50 g/mol |
| Exact Mass | 425.18 |
| IUPAC Name | (2E,4E)-5-[3-(4-fluorophenyl)-1-propan-2-ylindol-2-yl]-1-(2-hydroxyphenyl)penta-2,4-dien-1-one |
| SMILES | CC(C)n1c(/C=C/C=C/C(=O)c2ccccc2O)c(-c2ccc(F)cc2)c2ccccc21 |
| InChI | InChI=1S/C28H24FNO2/c1-19(2)30-24-11-5-3-9-22(24)28(20-15-17-21(29)18-16-20)25(30)12-6-8-14-27(32)23-10-4-7-13-26(23)31/h3-19,31H,1-2H3/b12-6+,14-8+ |
| InChIKey | AIMDEFLXWCDVDL-NJPPSALASA-N |
| XLogP | 7.19 |
| TPSA | 42.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.50 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|