C15H28O3 — CID 139200325
(1S,3S,6aS)-3-[(2R)-4-hydroxybutan-2-yl]-5,5,6a-trimethyl-1,2,3,6-tetrahydropentalen-1-ol;hydrate (PubChem CID 139200325) has the molecular formula C15H28O3 and a molecular weight of 256.39 g/mol. Its IUPAC name is (1S,3S,6aS)-3-[(2R)-4-hydroxybutan-2-yl]-5,5,6a-trimethyl-1,2,3,6-tetrahydropentalen-1-ol;hydrate.
| Compound Name | (1S,3S,6aS)-3-[(2R)-4-hydroxybutan-2-yl]-5,5,6a-trimethyl-1,2,3,6-tetrahydropentalen-1-ol;hydrate |
|---|---|
| PubChem CID | 139200325 |
| Molecular Formula | C15H28O3 |
| Molecular Weight | 256.39 g/mol |
| Exact Mass | 256.20 |
| IUPAC Name | (1S,3S,6aS)-3-[(2R)-4-hydroxybutan-2-yl]-5,5,6a-trimethyl-1,2,3,6-tetrahydropentalen-1-ol;hydrate |
| SMILES | C[C@H](CCO)[C@@H]1C[C@H](O)[C@@]2(C)CC(C)(C)C=C12.O |
| InChI | InChI=1S/C15H26O2.H2O/c1-10(5-6-16)11-7-13(17)15(4)9-14(2,3)8-12(11)15;/h8,10-11,13,16-17H,5-7,9H2,1-4H3;1H2/t10-,11+,13+,15+;/m1./s1 |
| InChIKey | UEOWYWBNCFUKQU-XNZCUVLASA-N |
| XLogP | 1.92 |
| TPSA | 71.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.39 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|