C36H48N2O8 — CID 139200649
5,18-dibutyl-2,8,15,21-tetraoxa-5,18-diazatricyclo[20.4.0.09,14]hexacosa-1(26),9,11,13,22,24-hexaene;terephthalic acid (PubChem CID 139200649) has the molecular formula C36H48N2O8 and a molecular weight of 636.79 g/mol. Its IUPAC name is 5,18-dibutyl-2,8,15,21-tetraoxa-5,18-diazatricyclo[20.4.0.09,14]hexacosa-1(26),9,11,13,22,24-hexaene;terephthalic acid.
| Compound Name | 5,18-dibutyl-2,8,15,21-tetraoxa-5,18-diazatricyclo[20.4.0.09,14]hexacosa-1(26),9,11,13,22,24-hexaene;terephthalic acid |
|---|---|
| PubChem CID | 139200649 |
| Molecular Formula | C36H48N2O8 |
| Molecular Weight | 636.79 g/mol |
| Exact Mass | 636.34 |
| IUPAC Name | 5,18-dibutyl-2,8,15,21-tetraoxa-5,18-diazatricyclo[20.4.0.09,14]hexacosa-1(26),9,11,13,22,24-hexaene;terephthalic acid |
| SMILES | CCCCN1CCOc2ccccc2OCCN(CCCC)CCOc2ccccc2OCC1.O=C(O)c1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C28H42N2O4.C8H6O4/c1-3-5-15-29-17-21-31-25-11-7-9-13-27(25)33-23-19-30(16-6-4-2)20-24-34-28-14-10-8-12-26(28)32-22-18-29;9-7(10)5-1-2-6(4-3-5)8(11)12/h7-14H,3-6,15-24H2,1-2H3;1-4H,(H,9,10)(H,11,12) |
| InChIKey | VDIUDIPYUHKJAR-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 118.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.79 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |