C19H18O3 — CID 139200671
(7aR)-7a-hydroxy-9,9-dimethyl-8,10-dihydrobenzo[a]xanthen-11-one (PubChem CID 139200671) has the molecular formula C19H18O3 and a molecular weight of 294.35 g/mol. Its IUPAC name is (7aR)-7a-hydroxy-9,9-dimethyl-8,10-dihydrobenzo[a]xanthen-11-one.
| Compound Name | (7aR)-7a-hydroxy-9,9-dimethyl-8,10-dihydrobenzo[a]xanthen-11-one |
|---|---|
| PubChem CID | 139200671 |
| Molecular Formula | C19H18O3 |
| Molecular Weight | 294.35 g/mol |
| Exact Mass | 294.13 |
| IUPAC Name | (7aR)-7a-hydroxy-9,9-dimethyl-8,10-dihydrobenzo[a]xanthen-11-one |
| SMILES | CC1(C)CC(=O)C2=Cc3c(ccc4ccccc34)O[C@]2(O)C1 |
| InChI | InChI=1S/C19H18O3/c1-18(2)10-16(20)15-9-14-13-6-4-3-5-12(13)7-8-17(14)22-19(15,21)11-18/h3-9,21H,10-11H2,1-2H3/t19-/m1/s1 |
| InChIKey | PAEZMFGOSZIRIQ-LJQANCHMSA-N |
| XLogP | 3.69 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.35 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |