C14H9F3O3 — CID 830125
(3R)-3-hydroxy-3-(trifluoromethyl)-2H-benzo[f]chromen-1-one (PubChem CID 830125) has the molecular formula C14H9F3O3 and a molecular weight of 282.22 g/mol. Its IUPAC name is (3R)-3-hydroxy-3-(trifluoromethyl)-2H-benzo[f]chromen-1-one.
| Compound Name | (3R)-3-hydroxy-3-(trifluoromethyl)-2H-benzo[f]chromen-1-one |
|---|---|
| PubChem CID | 830125 |
| Molecular Formula | C14H9F3O3 |
| Molecular Weight | 282.22 g/mol |
| Exact Mass | 282.05 |
| IUPAC Name | (3R)-3-hydroxy-3-(trifluoromethyl)-2H-benzo[f]chromen-1-one |
| SMILES | O=C1C[C@](O)(C(F)(F)F)Oc2ccc3ccccc3c21 |
| InChI | InChI=1S/C14H9F3O3/c15-14(16,17)13(19)7-10(18)12-9-4-2-1-3-8(9)5-6-11(12)20-13/h1-6,19H,7H2/t13-/m1/s1 |
| InChIKey | FJLGHQIGIXVHEH-CYBMUJFWSA-N |
| XLogP | 3.06 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.22 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |