C36H24O6 — CID 139042115
(2R)-2-hydroxy-2-phenylbenzo[e][1]benzofuran-1-one (PubChem CID 139042115) has the molecular formula C36H24O6 and a molecular weight of 552.58 g/mol. Its IUPAC name is (2R)-2-hydroxy-2-phenylbenzo[e][1]benzofuran-1-one.
| Compound Name | (2R)-2-hydroxy-2-phenylbenzo[e][1]benzofuran-1-one |
|---|---|
| PubChem CID | 139042115 |
| Molecular Formula | C36H24O6 |
| Molecular Weight | 552.58 g/mol |
| Exact Mass | 552.16 |
| IUPAC Name | (2R)-2-hydroxy-2-phenylbenzo[e][1]benzofuran-1-one |
| SMILES | O=C1c2c(ccc3ccccc23)O[C@]1(O)c1ccccc1.O=C1c2c(ccc3ccccc23)O[C@]1(O)c1ccccc1 |
| InChI | InChI=1S/2C18H12O3/c2*19-17-16-14-9-5-4-6-12(14)10-11-15(16)21-18(17,20)13-7-2-1-3-8-13/h2*1-11,20H/t2*18-/m11/s1 |
| InChIKey | RAEYHCULLPKWEX-BJRQBULFSA-N |
| XLogP | 6.52 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.58 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |