C25H24IN3O2 — CID 1392008
3-iodo-N-[4-[4-(2-methylbenzoyl)piperazin-1-yl]phenyl]benzamide (PubChem CID 1392008) has the molecular formula C25H24IN3O2 and a molecular weight of 525.39 g/mol. Its IUPAC name is 3-iodo-N-[4-[4-(2-methylbenzoyl)piperazin-1-yl]phenyl]benzamide.
| Compound Name | 3-iodo-N-[4-[4-(2-methylbenzoyl)piperazin-1-yl]phenyl]benzamide |
|---|---|
| PubChem CID | 1392008 |
| Molecular Formula | C25H24IN3O2 |
| Molecular Weight | 525.39 g/mol |
| Exact Mass | 525.09 |
| IUPAC Name | 3-iodo-N-[4-[4-(2-methylbenzoyl)piperazin-1-yl]phenyl]benzamide |
| SMILES | Cc1ccccc1C(=O)N1CCN(c2ccc(NC(=O)c3cccc(I)c3)cc2)CC1 |
| InChI | InChI=1S/C25H24IN3O2/c1-18-5-2-3-8-23(18)25(31)29-15-13-28(14-16-29)22-11-9-21(10-12-22)27-24(30)19-6-4-7-20(26)17-19/h2-12,17H,13-16H2,1H3,(H,27,30) |
| InChIKey | LVMDIJAEAJADQT-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.39 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|