About copper;bis(5-hydroxy-2-[(E)-hydroxyiminomethyl]phenolate);4-pyridin-4-ylpyridine
copper;bis(5-hydroxy-2-[(E)-hydroxyiminomethyl]phenolate);4-pyridin-4-ylpyridine (PubChem CID 139200891) has the molecular formula C24H20CuN4O6
and a molecular weight of 523.99 g/mol. Its IUPAC name is copper;bis(5-hydroxy-2-[(E)-hydroxyiminomethyl]phenolate);4-pyridin-4-ylpyridine.
Molecular Properties
| Compound Name | copper;bis(5-hydroxy-2-[(E)-hydroxyiminomethyl]phenolate);4-pyridin-4-ylpyridine |
| PubChem CID | 139200891 |
| Molecular Formula | C24H20CuN4O6 |
| Molecular Weight | 523.99 g/mol |
| Exact Mass | 523.07 |
| IUPAC Name | copper;bis(5-hydroxy-2-[(E)-hydroxyiminomethyl]phenolate);4-pyridin-4-ylpyridine |
| SMILES | [Cu+2].[O-]c1cc(O)ccc1/C=N/O.[O-]c1cc(O)ccc1/C=N/O.c1cc(-c2ccncc2)ccn1 |
| InChI | InChI=1S/C10H8N2.2C7H7NO3.Cu/c1-5-11-6-2-9(1)10-3-7-12-8-4-10;2*9-6-2-1-5(4-8-11)7(10)3-6;/h1-8H;2*1-4,9-11H;/q;;;+2/p-2/b;2*8-4+; |
| InChIKey | WBZCFMWEBVHYNO-LPDMCXDZSA-L |
| XLogP | 2.69 |
| TPSA | 177.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 523.99 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze copper;bis(5-hydroxy-2-[(E)-hydroxyiminomethyl]phenolate);4-pyridin-4-ylpyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of copper;bis(5-hydroxy-2-[(E)-hydroxyiminomethyl]phenolate);4-pyridin-4-ylpyridine?
The IUPAC name of copper;bis(5-hydroxy-2-[(E)-hydroxyiminomethyl]phenolate);4-pyridin-4-ylpyridine (CID 139200891) is copper;bis(5-hydroxy-2-[(E)-hydroxyiminomethyl]phenolate);4-pyridin-4-ylpyridine.
What is the SMILES notation for copper;bis(5-hydroxy-2-[(E)-hydroxyiminomethyl]phenolate);4-pyridin-4-ylpyridine?
The canonical SMILES for copper;bis(5-hydroxy-2-[(E)-hydroxyiminomethyl]phenolate);4-pyridin-4-ylpyridine is [Cu+2].[O-]c1cc(O)ccc1/C=N/O.[O-]c1cc(O)ccc1/C=N/O.c1cc(-c2ccncc2)ccn1.
What is the InChIKey of copper;bis(5-hydroxy-2-[(E)-hydroxyiminomethyl]phenolate);4-pyridin-4-ylpyridine?
The InChIKey is WBZCFMWEBVHYNO-LPDMCXDZSA-L. The full InChI is InChI=1S/C10H8N2.2C7H7NO3.Cu/c1-5-11-6-2-9(1)10-3-7-12-8-4-10;2*9-6-2-1-5(4-8-11)7(10)3-6;/h1-8H;2*1-4,9-11H;/q;;;+2/p-2/b;2*8-4+;.
What are the key properties of copper;bis(5-hydroxy-2-[(E)-hydroxyiminomethyl]phenolate);4-pyridin-4-ylpyridine?
copper;bis(5-hydroxy-2-[(E)-hydroxyiminomethyl]phenolate);4-pyridin-4-ylpyridine has a molecular weight of 523.99 g/mol, XLogP of 2.69, 3 rotatable bonds, 4 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for copper;bis(5-hydroxy-2-[(E)-hydroxyiminomethyl]phenolate);4-pyridin-4-ylpyridine is sourced from PubChem (CID 139200891), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).