C21H21N3O4 — CID 137250088
2-[C-[2-(4-hydroxyphenyl)ethyl]-N-(pyridin-4-ylmethylamino)carbonimidoyl]benzene-1,3,5-triol (PubChem CID 137250088) has the molecular formula C21H21N3O4 and a molecular weight of 379.42 g/mol. Its IUPAC name is 2-[C-[2-(4-hydroxyphenyl)ethyl]-N-(pyridin-4-ylmethylamino)carbonimidoyl]benzene-1,3,5-triol.
| Compound Name | 2-[C-[2-(4-hydroxyphenyl)ethyl]-N-(pyridin-4-ylmethylamino)carbonimidoyl]benzene-1,3,5-triol |
|---|---|
| PubChem CID | 137250088 |
| Molecular Formula | C21H21N3O4 |
| Molecular Weight | 379.42 g/mol |
| Exact Mass | 379.15 |
| IUPAC Name | 2-[C-[2-(4-hydroxyphenyl)ethyl]-N-(pyridin-4-ylmethylamino)carbonimidoyl]benzene-1,3,5-triol |
| SMILES | Oc1ccc(CCC(=NNCc2ccncc2)c2c(O)cc(O)cc2O)cc1 |
| InChI | InChI=1S/C21H21N3O4/c25-16-4-1-14(2-5-16)3-6-18(21-19(27)11-17(26)12-20(21)28)24-23-13-15-7-9-22-10-8-15/h1-2,4-5,7-12,23,25-28H,3,6,13H2 |
| InChIKey | HIJRCZCUBGIPID-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 118.20 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.42 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|