C16H17N3O3 — CID 135699730
[(E)-[1-(2,4-dihydroxyphenyl)-3-phenylpropylidene]amino]urea (PubChem CID 135699730) has the molecular formula C16H17N3O3 and a molecular weight of 299.33 g/mol. Its IUPAC name is [(E)-[1-(2,4-dihydroxyphenyl)-3-phenylpropylidene]amino]urea.
| Compound Name | [(E)-[1-(2,4-dihydroxyphenyl)-3-phenylpropylidene]amino]urea |
|---|---|
| PubChem CID | 135699730 |
| Molecular Formula | C16H17N3O3 |
| Molecular Weight | 299.33 g/mol |
| Exact Mass | 299.13 |
| IUPAC Name | [(E)-[1-(2,4-dihydroxyphenyl)-3-phenylpropylidene]amino]urea |
| SMILES | NC(=O)N/N=C(\CCc1ccccc1)c1ccc(O)cc1O |
| InChI | InChI=1S/C16H17N3O3/c17-16(22)19-18-14(9-6-11-4-2-1-3-5-11)13-8-7-12(20)10-15(13)21/h1-5,7-8,10,20-21H,6,9H2,(H3,17,19,22)/b18-14+ |
| InChIKey | ALCNZFMETMAZCT-NBVRZTHBSA-N |
| XLogP | 2.10 |
| TPSA | 107.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.33 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|