C12H20F3N2S+ — CID 139202071
4,5-dimethyl-1,3-di(propan-2-yl)-2-(trifluoromethylsulfanyl)imidazol-1-ium (PubChem CID 139202071) has the molecular formula C12H20F3N2S+ and a molecular weight of 281.37 g/mol. Its IUPAC name is 4,5-dimethyl-1,3-di(propan-2-yl)-2-(trifluoromethylsulfanyl)imidazol-1-ium.
| Compound Name | 4,5-dimethyl-1,3-di(propan-2-yl)-2-(trifluoromethylsulfanyl)imidazol-1-ium |
|---|---|
| PubChem CID | 139202071 |
| Molecular Formula | C12H20F3N2S+ |
| Molecular Weight | 281.37 g/mol |
| Exact Mass | 281.13 |
| IUPAC Name | 4,5-dimethyl-1,3-di(propan-2-yl)-2-(trifluoromethylsulfanyl)imidazol-1-ium |
| SMILES | Cc1c(C)[n+](C(C)C)c(SC(F)(F)F)n1C(C)C |
| InChI | InChI=1S/C12H20F3N2S/c1-7(2)16-9(5)10(6)17(8(3)4)11(16)18-12(13,14)15/h7-8H,1-6H3/q+1 |
| InChIKey | HWAYJAXIZNSCGO-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 8.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.37 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|