About piperazine-1-carboxylate;piperazin-1-ium
piperazine-1-carboxylate;piperazin-1-ium (PubChem CID 139202384) has the molecular formula C9H20N4O2
and a molecular weight of 216.28 g/mol. Its IUPAC name is piperazine-1-carboxylate;piperazin-1-ium.
Molecular Properties
| Compound Name | piperazine-1-carboxylate;piperazin-1-ium |
| PubChem CID | 139202384 |
| Molecular Formula | C9H20N4O2 |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.16 |
| IUPAC Name | piperazine-1-carboxylate;piperazin-1-ium |
| SMILES | C1C[NH2+]CCN1.O=C([O-])N1CCNCC1 |
| InChI | InChI=1S/C5H10N2O2.C4H10N2/c8-5(9)7-3-1-6-2-4-7;1-2-6-4-3-5-1/h6H,1-4H2,(H,8,9);5-6H,1-4H2 |
| InChIKey | ONNZUOIQLMQXOP-UHFFFAOYSA-N |
| XLogP | -3.61 |
| TPSA | 84.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | -3.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze piperazine-1-carboxylate;piperazin-1-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of piperazine-1-carboxylate;piperazin-1-ium?
The IUPAC name of piperazine-1-carboxylate;piperazin-1-ium (CID 139202384) is piperazine-1-carboxylate;piperazin-1-ium.
What is the SMILES notation for piperazine-1-carboxylate;piperazin-1-ium?
The canonical SMILES for piperazine-1-carboxylate;piperazin-1-ium is C1C[NH2+]CCN1.O=C([O-])N1CCNCC1.
What is the InChIKey of piperazine-1-carboxylate;piperazin-1-ium?
The InChIKey is ONNZUOIQLMQXOP-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10N2O2.C4H10N2/c8-5(9)7-3-1-6-2-4-7;1-2-6-4-3-5-1/h6H,1-4H2,(H,8,9);5-6H,1-4H2.
What are the key properties of piperazine-1-carboxylate;piperazin-1-ium?
piperazine-1-carboxylate;piperazin-1-ium has a molecular weight of 216.28 g/mol, XLogP of -3.61, 0 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for piperazine-1-carboxylate;piperazin-1-ium is sourced from PubChem (CID 139202384), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).