C23H23N5O5S2 — CID 139203744
2-[(5Z)-5-[(E)-2-methyl-3-phenylprop-2-enylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetic acid;1,3,7-trimethylpurine-2,6-dione (PubChem CID 139203744) has the molecular formula C23H23N5O5S2 and a molecular weight of 513.60 g/mol. Its IUPAC name is 2-[(5Z)-5-[(E)-2-methyl-3-phenylprop-2-enylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetic acid;1,3,7-trimethylpurine-2,6-dione.
| Compound Name | 2-[(5Z)-5-[(E)-2-methyl-3-phenylprop-2-enylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetic acid;1,3,7-trimethylpurine-2,6-dione |
|---|---|
| PubChem CID | 139203744 |
| Molecular Formula | C23H23N5O5S2 |
| Molecular Weight | 513.60 g/mol |
| Exact Mass | 513.11 |
| IUPAC Name | 2-[(5Z)-5-[(E)-2-methyl-3-phenylprop-2-enylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetic acid;1,3,7-trimethylpurine-2,6-dione |
| SMILES | CC(/C=C1\SC(=S)N(CC(=O)O)C1=O)=C\c1ccccc1.Cn1c(=O)c2c(ncn2C)n(C)c1=O |
| InChI | InChI=1S/C15H13NO3S2.C8H10N4O2/c1-10(7-11-5-3-2-4-6-11)8-12-14(19)16(9-13(17)18)15(20)21-12;1-10-4-9-6-5(10)7(13)12(3)8(14)11(6)2/h2-8H,9H2,1H3,(H,17,18);4H,1-3H3/b10-7+,12-8-; |
| InChIKey | RXTLQQUFGVCFSZ-ZTSQLAHISA-N |
| XLogP | 1.89 |
| TPSA | 119.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.60 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|