C13H11ClO3 — CID 139204728
(1S,3E,5R)-3-[(4-chlorophenyl)methylidene]-6,8-dioxabicyclo[3.2.1]octan-4-one (PubChem CID 139204728) has the molecular formula C13H11ClO3 and a molecular weight of 250.68 g/mol. Its IUPAC name is (1S,3E,5R)-3-[(4-chlorophenyl)methylidene]-6,8-dioxabicyclo[3.2.1]octan-4-one.
| Compound Name | (1S,3E,5R)-3-[(4-chlorophenyl)methylidene]-6,8-dioxabicyclo[3.2.1]octan-4-one |
|---|---|
| PubChem CID | 139204728 |
| Molecular Formula | C13H11ClO3 |
| Molecular Weight | 250.68 g/mol |
| Exact Mass | 250.04 |
| IUPAC Name | (1S,3E,5R)-3-[(4-chlorophenyl)methylidene]-6,8-dioxabicyclo[3.2.1]octan-4-one |
| SMILES | O=C1/C(=C/c2ccc(Cl)cc2)C[C@H]2CO[C@@H]1O2 |
| InChI | InChI=1S/C13H11ClO3/c14-10-3-1-8(2-4-10)5-9-6-11-7-16-13(17-11)12(9)15/h1-5,11,13H,6-7H2/b9-5+/t11-,13+/m0/s1 |
| InChIKey | MGOGDBBHULGVDR-CSCBSUNKSA-N |
| XLogP | 2.44 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.68 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|