C11H11N3O5 — CID 139205213
4-aminobenzoic acid;1,3-diazinane-2,4,6-trione (PubChem CID 139205213) has the molecular formula C11H11N3O5 and a molecular weight of 265.23 g/mol. Its IUPAC name is 4-aminobenzoic acid;1,3-diazinane-2,4,6-trione.
| Compound Name | 4-aminobenzoic acid;1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 139205213 |
| Molecular Formula | C11H11N3O5 |
| Molecular Weight | 265.23 g/mol |
| Exact Mass | 265.07 |
| IUPAC Name | 4-aminobenzoic acid;1,3-diazinane-2,4,6-trione |
| SMILES | Nc1ccc(C(=O)O)cc1.O=C1CC(=O)NC(=O)N1 |
| InChI | InChI=1S/C7H7NO2.C4H4N2O3/c8-6-3-1-5(2-4-6)7(9)10;7-2-1-3(8)6-4(9)5-2/h1-4H,8H2,(H,9,10);1H2,(H2,5,6,7,8,9) |
| InChIKey | PBKUEKDNMITGMO-UHFFFAOYSA-N |
| XLogP | -0.29 |
| TPSA | 138.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.23 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|