C26H25N3O3S — CID 139210820
3-amino-4-(2,5-dimethoxyphenyl)-N-phenyl-5,6,7,8-tetrahydrothieno[2,3-b]quinoline-2-carboxamide (PubChem CID 139210820) has the molecular formula C26H25N3O3S and a molecular weight of 459.57 g/mol. Its IUPAC name is 3-amino-4-(2,5-dimethoxyphenyl)-N-phenyl-5,6,7,8-tetrahydrothieno[2,3-b]quinoline-2-carboxamide.
| Compound Name | 3-amino-4-(2,5-dimethoxyphenyl)-N-phenyl-5,6,7,8-tetrahydrothieno[2,3-b]quinoline-2-carboxamide |
|---|---|
| PubChem CID | 139210820 |
| Molecular Formula | C26H25N3O3S |
| Molecular Weight | 459.57 g/mol |
| Exact Mass | 459.16 |
| IUPAC Name | 3-amino-4-(2,5-dimethoxyphenyl)-N-phenyl-5,6,7,8-tetrahydrothieno[2,3-b]quinoline-2-carboxamide |
| SMILES | COc1ccc(OC)c(-c2c3c(nc4sc(C(=O)Nc5ccccc5)c(N)c24)CCCC3)c1 |
| InChI | InChI=1S/C26H25N3O3S/c1-31-16-12-13-20(32-2)18(14-16)21-17-10-6-7-11-19(17)29-26-22(21)23(27)24(33-26)25(30)28-15-8-4-3-5-9-15/h3-5,8-9,12-14H,6-7,10-11,27H2,1-2H3,(H,28,30) |
| InChIKey | HBSKEIXXNUIJRB-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 86.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.57 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |